C28H42FN — CID 143683718
6-[(6Z,7Z)-3-[(3S,4R)-3-ethyl-3,4-dimethylcyclopentyl]-9-fluoro-8-methyl-6-prop-2-enylidenedeca-1,7-dien-2-yl]-3,4-dihydropyridine (PubChem CID 143683718) has the molecular formula C28H42FN and a molecular weight of 411.65 g/mol. Its IUPAC name is 6-[(6Z,7Z)-3-[(3S,4R)-3-ethyl-3,4-dimethylcyclopentyl]-9-fluoro-8-methyl-6-prop-2-enylidenedeca-1,7-dien-2-yl]-3,4-dihydropyridine.
| Compound Name | 6-[(6Z,7Z)-3-[(3S,4R)-3-ethyl-3,4-dimethylcyclopentyl]-9-fluoro-8-methyl-6-prop-2-enylidenedeca-1,7-dien-2-yl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 143683718 |
| Molecular Formula | C28H42FN |
| Molecular Weight | 411.65 g/mol |
| Exact Mass | 411.33 |
| IUPAC Name | 6-[(6Z,7Z)-3-[(3S,4R)-3-ethyl-3,4-dimethylcyclopentyl]-9-fluoro-8-methyl-6-prop-2-enylidenedeca-1,7-dien-2-yl]-3,4-dihydropyridine |
| SMILES | C=C/C=C(\C=C(\C)C(C)F)CCC(C(=C)C1=CCCC=N1)C1C[C@@H](C)[C@@](C)(CC)C1 |
| InChI | InChI=1S/C28H42FN/c1-8-12-24(17-20(3)23(6)29)14-15-26(22(5)27-13-10-11-16-30-27)25-18-21(4)28(7,9-2)19-25/h8,12-13,16-17,21,23,25-26H,1,5,9-11,14-15,18-19H2,2-4,6-7H3/b20-17-,24-12-/t21-,23?,25?,26?,28+/m1/s1 |
| InChIKey | BTXONZCMQKVAOJ-CTUAMZQOSA-N |
| XLogP | 8.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.65 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|