C26H37N — CID 123555378
3-[2,5,5,6-tetramethyl-3-(6-methylcyclohexa-1,5-dien-1-yl)hept-6-en-3-yl]-3a,7a-dihydro-3H-indole (PubChem CID 123555378) has the molecular formula C26H37N and a molecular weight of 363.59 g/mol. Its IUPAC name is 3-[2,5,5,6-tetramethyl-3-(6-methylcyclohexa-1,5-dien-1-yl)hept-6-en-3-yl]-3a,7a-dihydro-3H-indole.
| Compound Name | 3-[2,5,5,6-tetramethyl-3-(6-methylcyclohexa-1,5-dien-1-yl)hept-6-en-3-yl]-3a,7a-dihydro-3H-indole |
|---|---|
| PubChem CID | 123555378 |
| Molecular Formula | C26H37N |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | 3-[2,5,5,6-tetramethyl-3-(6-methylcyclohexa-1,5-dien-1-yl)hept-6-en-3-yl]-3a,7a-dihydro-3H-indole |
| SMILES | C=C(C)C(C)(C)CC(C1=CCCC=C1C)(C(C)C)C1C=NC2C=CC=CC21 |
| InChI | InChI=1S/C26H37N/c1-18(2)25(6,7)17-26(19(3)4,22-14-10-8-12-20(22)5)23-16-27-24-15-11-9-13-21(23)24/h9,11-16,19,21,23-24H,1,8,10,17H2,2-7H3 |
| InChIKey | BZSVOLGBRRRWCE-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|