C16H20N2 — CID 57141995
10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene (PubChem CID 57141995) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene.
| Compound Name | 10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene |
|---|---|
| PubChem CID | 57141995 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene |
| SMILES | CC1C2CC3C(=N2)CCC2=C3C=CC/N=C\C21C |
| InChI | InChI=1S/C16H20N2/c1-10-15-8-12-11-4-3-7-17-9-16(10,2)13(11)5-6-14(12)18-15/h3-4,9-10,12,15H,5-8H2,1-2H3/b4-3?,17-9- |
| InChIKey | AWPRRVNDTQAHBU-CBXFVSJUSA-N |
| XLogP | 3.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |