C19H26N2 — CID 54029902
10,16-diethyl-15-methyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene (PubChem CID 54029902) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 10,16-diethyl-15-methyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene.
| Compound Name | 10,16-diethyl-15-methyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
|---|---|
| PubChem CID | 54029902 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 10,16-diethyl-15-methyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
| SMILES | CCC1C2CC3=C(CCC4=C3C=CC/N=C\C41CC)N2C |
| InChI | InChI=1S/C19H26N2/c1-4-15-18-11-14-13-7-6-10-20-12-19(15,5-2)16(13)8-9-17(14)21(18)3/h6-7,12,15,18H,4-5,8-11H2,1-3H3/b7-6?,20-12- |
| InChIKey | LEVNLEJNAJIQEO-CWERQSCMSA-N |
| XLogP | 4.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |