C15H18N2 — CID 19879738
(5Z)-15-methyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene (PubChem CID 19879738) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (5Z)-15-methyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene.
| Compound Name | (5Z)-15-methyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
|---|---|
| PubChem CID | 19879738 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (5Z)-15-methyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
| SMILES | CN1C2=C3CC1CC1/C=N\C/C=C\C3=C1CC2 |
| InChI | InChI=1S/C15H18N2/c1-17-11-7-10-9-16-6-2-3-13-12(10)4-5-15(17)14(13)8-11/h2-3,9-11H,4-8H2,1H3/b3-2-,16-9- |
| InChIKey | YHJUFZKIUSNVJY-USYAOKSRSA-N |
| XLogP | 2.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |