C19H26N2 — CID 19879754
(5Z)-10,16-dimethyl-15-prop-2-enyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5-triene (PubChem CID 19879754) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (5Z)-10,16-dimethyl-15-prop-2-enyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5-triene.
| Compound Name | (5Z)-10,16-dimethyl-15-prop-2-enyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5-triene |
|---|---|
| PubChem CID | 19879754 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (5Z)-10,16-dimethyl-15-prop-2-enyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5-triene |
| SMILES | C=CCN1C2=C3CC1C(C)C1(C)CNC/C=C\C3=C1CC2 |
| InChI | InChI=1S/C19H26N2/c1-4-10-21-17-8-7-16-14-6-5-9-20-12-19(16,3)13(2)18(21)11-15(14)17/h4-6,13,18,20H,1,7-12H2,2-3H3/b6-5- |
| InChIKey | ZIBMETJOKNKJBK-WAYWQWQTSA-N |
| XLogP | 3.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|