C19H28N2 — CID 57113705
10,16-diethyl-15-methyl-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),8-triene (PubChem CID 57113705) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 10,16-diethyl-15-methyl-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),8-triene.
| Compound Name | 10,16-diethyl-15-methyl-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),8-triene |
|---|---|
| PubChem CID | 57113705 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 10,16-diethyl-15-methyl-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),8-triene |
| SMILES | CCC1C2N=C3CC4=C(CC3C2C)CC1(CC)/C=N\CC4 |
| InChI | InChI=1S/C19H28N2/c1-4-16-18-12(3)15-8-14-10-19(16,5-2)11-20-7-6-13(14)9-17(15)21-18/h11-12,15-16,18H,4-10H2,1-3H3/b20-11- |
| InChIKey | WIRURNGFERDGGF-JAIQZWGSSA-N |
| XLogP | 4.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|