C15H20N2 — CID 57021968
15-methyl-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),8-triene (PubChem CID 57021968) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 15-methyl-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),8-triene.
| Compound Name | 15-methyl-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),8-triene |
|---|---|
| PubChem CID | 57021968 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 15-methyl-2,8-diazatetracyclo[8.5.1.03,14.05,12]hexadeca-2,5(12),8-triene |
| SMILES | CC1C2CC3/C=N\CCC4=C(C3)CC1C(=N2)C4 |
| InChI | InChI=1S/C15H20N2/c1-9-13-6-12-4-10-5-14(9)17-15(13)7-11(12)2-3-16-8-10/h8-10,13-14H,2-7H2,1H3/b16-8- |
| InChIKey | SNDBCFTVCJCNKS-PXNMLYILSA-N |
| XLogP | 3.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|