C16H19ClN2 — CID 57157118
6-chloro-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene (PubChem CID 57157118) has the molecular formula C16H19ClN2 and a molecular weight of 274.79 g/mol. Its IUPAC name is 6-chloro-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene.
| Compound Name | 6-chloro-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene |
|---|---|
| PubChem CID | 57157118 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 6-chloro-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene |
| SMILES | CC1C2CC3C(=N2)CCC2=C3C=C(Cl)C/N=C\C21C |
| InChI | InChI=1S/C16H19ClN2/c1-9-15-6-12-11-5-10(17)7-18-8-16(9,2)13(11)3-4-14(12)19-15/h5,8-9,12,15H,3-4,6-7H2,1-2H3/b10-5?,18-8- |
| InChIKey | JWLNRKBBXGCOIT-USMRSXRTSA-N |
| XLogP | 3.77 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |