C18H23ClN2 — CID 54291701
6-chloro-15-ethyl-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene (PubChem CID 54291701) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 6-chloro-15-ethyl-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene.
| Compound Name | 6-chloro-15-ethyl-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
|---|---|
| PubChem CID | 54291701 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 6-chloro-15-ethyl-10,16-dimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
| SMILES | CCN1C2=C3CC1C(C)C1(C)/C=N\CC(Cl)=CC3=C1CC2 |
| InChI | InChI=1S/C18H23ClN2/c1-4-21-16-6-5-15-13-7-12(19)9-20-10-18(15,3)11(2)17(21)8-14(13)16/h7,10-11,17H,4-6,8-9H2,1-3H3/b12-7?,20-10- |
| InChIKey | RXYIGMBATRNSJH-MGJAUIFVSA-N |
| XLogP | 4.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |