C19H23ClN2 — CID 54508834
6-chloro-10,16-dimethyl-15-prop-2-enyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene (PubChem CID 54508834) has the molecular formula C19H23ClN2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 6-chloro-10,16-dimethyl-15-prop-2-enyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene.
| Compound Name | 6-chloro-10,16-dimethyl-15-prop-2-enyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
|---|---|
| PubChem CID | 54508834 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 6-chloro-10,16-dimethyl-15-prop-2-enyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-3(14),4(11),5,8-tetraene |
| SMILES | C=CCN1C2=C3CC1C(C)C1(C)/C=N\CC(Cl)=CC3=C1CC2 |
| InChI | InChI=1S/C19H23ClN2/c1-4-7-22-17-6-5-16-14-8-13(20)10-21-11-19(16,3)12(2)18(22)9-15(14)17/h4,8,11-12,18H,1,5-7,9-10H2,2-3H3/b13-8?,21-11- |
| InChIKey | YHQQUBIKGCFGKQ-ZIURWOFOSA-N |
| XLogP | 4.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|