C17H21ClN2 — CID 57047997
6-chloro-9,10,16-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene (PubChem CID 57047997) has the molecular formula C17H21ClN2 and a molecular weight of 288.82 g/mol. Its IUPAC name is 6-chloro-9,10,16-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene.
| Compound Name | 6-chloro-9,10,16-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene |
|---|---|
| PubChem CID | 57047997 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 6-chloro-9,10,16-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-4(11),5,8,14-tetraene |
| SMILES | C/C1=N/CC(Cl)=CC2=C3CCC4=NC(CC42)C(C)C31C |
| InChI | InChI=1S/C17H21ClN2/c1-9-16-7-13-12-6-11(18)8-19-10(2)17(9,3)14(12)4-5-15(13)20-16/h6,9,13,16H,4-5,7-8H2,1-3H3/b11-6?,19-10- |
| InChIKey | DPGZJNZAIUEBJW-VVJJSFIBSA-N |
| XLogP | 4.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |