C15H23N — CID 91334885
2-(3-ethyl-4,5-dimethylcyclohexen-1-yl)-2,5-dihydropyridine (PubChem CID 91334885) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 2-(3-ethyl-4,5-dimethylcyclohexen-1-yl)-2,5-dihydropyridine.
| Compound Name | 2-(3-ethyl-4,5-dimethylcyclohexen-1-yl)-2,5-dihydropyridine |
|---|---|
| PubChem CID | 91334885 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2-(3-ethyl-4,5-dimethylcyclohexen-1-yl)-2,5-dihydropyridine |
| SMILES | CCC1C=C(C2C=CCC=N2)CC(C)C1C |
| InChI | InChI=1S/C15H23N/c1-4-13-10-14(9-11(2)12(13)3)15-7-5-6-8-16-15/h5,7-8,10-13,15H,4,6,9H2,1-3H3 |
| InChIKey | UDIMQRJNCVFVGO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|