C23H33N — CID 123268418
(Z)-5-methyl-N-(1,9,9-trimethyl-1,2,3,4b,8a,9a-hexahydrofluoren-2-yl)hex-3-en-2-imine (PubChem CID 123268418) has the molecular formula C23H33N and a molecular weight of 323.52 g/mol. Its IUPAC name is (Z)-5-methyl-N-(1,9,9-trimethyl-1,2,3,4b,8a,9a-hexahydrofluoren-2-yl)hex-3-en-2-imine.
| Compound Name | (Z)-5-methyl-N-(1,9,9-trimethyl-1,2,3,4b,8a,9a-hexahydrofluoren-2-yl)hex-3-en-2-imine |
|---|---|
| PubChem CID | 123268418 |
| Molecular Formula | C23H33N |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | (Z)-5-methyl-N-(1,9,9-trimethyl-1,2,3,4b,8a,9a-hexahydrofluoren-2-yl)hex-3-en-2-imine |
| SMILES | CC(/C=C\C(C)C)=N\C1CC=C2C3C=CC=CC3C(C)(C)C2C1C |
| InChI | InChI=1S/C23H33N/c1-15(2)11-12-16(3)24-21-14-13-19-18-9-7-8-10-20(18)23(5,6)22(19)17(21)4/h7-13,15,17-18,20-22H,14H2,1-6H3/b12-11-,24-16+ |
| InChIKey | BNSAFZNACHKMCX-CIWMCXQZSA-N |
| XLogP | 6.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|