C17H23N — CID 123604765
9-ethyl-N,9-dimethyl-3,8,8a,9a-tetrahydro-1H-fluoren-2-imine (PubChem CID 123604765) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 9-ethyl-N,9-dimethyl-3,8,8a,9a-tetrahydro-1H-fluoren-2-imine.
| Compound Name | 9-ethyl-N,9-dimethyl-3,8,8a,9a-tetrahydro-1H-fluoren-2-imine |
|---|---|
| PubChem CID | 123604765 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 9-ethyl-N,9-dimethyl-3,8,8a,9a-tetrahydro-1H-fluoren-2-imine |
| SMILES | CCC1(C)C2CC=CC=C2C2=CC/C(=N\C)CC21 |
| InChI | InChI=1S/C17H23N/c1-4-17(2)15-8-6-5-7-13(15)14-10-9-12(18-3)11-16(14)17/h5-7,10,15-16H,4,8-9,11H2,1-3H3/b18-12+ |
| InChIKey | UNTRCXLUBITRDK-LDADJPATSA-N |
| XLogP | 4.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|