C25H45N — CID 145299285
1-methyl-2-propylcyclopentane;(6Z,9Z)-N,7,8,11-tetramethyldodeca-6,9,11-trien-5-imine (PubChem CID 145299285) has the molecular formula C25H45N and a molecular weight of 359.64 g/mol. Its IUPAC name is 1-methyl-2-propylcyclopentane;(6Z,9Z)-N,7,8,11-tetramethyldodeca-6,9,11-trien-5-imine.
| Compound Name | 1-methyl-2-propylcyclopentane;(6Z,9Z)-N,7,8,11-tetramethyldodeca-6,9,11-trien-5-imine |
|---|---|
| PubChem CID | 145299285 |
| Molecular Formula | C25H45N |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 359.36 |
| IUPAC Name | 1-methyl-2-propylcyclopentane;(6Z,9Z)-N,7,8,11-tetramethyldodeca-6,9,11-trien-5-imine |
| SMILES | C=C(C)/C=C\C(C)/C(C)=C\C(CCCC)=N\C.CCCC1CCCC1C |
| InChI | InChI=1S/C16H27N.C9H18/c1-7-8-9-16(17-6)12-15(5)14(4)11-10-13(2)3;1-3-5-9-7-4-6-8(9)2/h10-12,14H,2,7-9H2,1,3-6H3;8-9H,3-7H2,1-2H3/b11-10-,15-12-,17-16+; |
| InChIKey | PIARKFWKGHLLCH-GOYPMJDESA-N |
| XLogP | 8.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|