C17H25N — CID 123586387
4-(3-cyclohepta-1,6-dien-1-ylpropyl)-N-methylcyclohex-2-en-1-imine (PubChem CID 123586387) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 4-(3-cyclohepta-1,6-dien-1-ylpropyl)-N-methylcyclohex-2-en-1-imine.
| Compound Name | 4-(3-cyclohepta-1,6-dien-1-ylpropyl)-N-methylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123586387 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 4-(3-cyclohepta-1,6-dien-1-ylpropyl)-N-methylcyclohex-2-en-1-imine |
| SMILES | C/N=C1\C=CC(CCCC2=CCCCC=C2)CC1 |
| InChI | InChI=1S/C17H25N/c1-18-17-13-11-16(12-14-17)10-6-9-15-7-4-2-3-5-8-15/h4,7-8,11,13,16H,2-3,5-6,9-10,12,14H2,1H3/b18-17+ |
| InChIKey | NBPSMCIJRSRVPW-ISLYRVAYSA-N |
| XLogP | 4.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|