C19H27N — CID 123304381
4-(cyclopentylmethyl)-10-ethyl-3-azabicyclo[5.4.1]dodeca-3,5,7,10-tetraene (PubChem CID 123304381) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 4-(cyclopentylmethyl)-10-ethyl-3-azabicyclo[5.4.1]dodeca-3,5,7,10-tetraene.
| Compound Name | 4-(cyclopentylmethyl)-10-ethyl-3-azabicyclo[5.4.1]dodeca-3,5,7,10-tetraene |
|---|---|
| PubChem CID | 123304381 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 4-(cyclopentylmethyl)-10-ethyl-3-azabicyclo[5.4.1]dodeca-3,5,7,10-tetraene |
| SMILES | CCC1=CC2C/N=C(/CC3CCCC3)C=CC(=CC1)C2 |
| InChI | InChI=1S/C19H27N/c1-2-15-7-8-17-9-10-19(13-16-5-3-4-6-16)20-14-18(11-15)12-17/h8-11,16,18H,2-7,12-14H2,1H3/b10-9?,20-19+ |
| InChIKey | NNWMWODJEBHYCR-XMFTWXQLSA-N |
| XLogP | 5.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|