C39H65N — CID 91245954
(Z)-10-cyclopentyl-5-ethenyl-N-[7-(4-ethylcycloocta-1,3-dien-1-yl)-2-propylheptyl]-8-methylideneundec-3-en-2-imine (PubChem CID 91245954) has the molecular formula C39H65N and a molecular weight of 547.96 g/mol. Its IUPAC name is (Z)-10-cyclopentyl-5-ethenyl-N-[7-(4-ethylcycloocta-1,3-dien-1-yl)-2-propylheptyl]-8-methylideneundec-3-en-2-imine.
| Compound Name | (Z)-10-cyclopentyl-5-ethenyl-N-[7-(4-ethylcycloocta-1,3-dien-1-yl)-2-propylheptyl]-8-methylideneundec-3-en-2-imine |
|---|---|
| PubChem CID | 91245954 |
| Molecular Formula | C39H65N |
| Molecular Weight | 547.96 g/mol |
| Exact Mass | 547.51 |
| IUPAC Name | (Z)-10-cyclopentyl-5-ethenyl-N-[7-(4-ethylcycloocta-1,3-dien-1-yl)-2-propylheptyl]-8-methylideneundec-3-en-2-imine |
| SMILES | C=CC(/C=C\C(C)=N\CC(CCC)CCCCCC1=CC=C(CC)CCCC1)CCC(=C)CC(C)C1CCCC1 |
| InChI | InChI=1S/C39H65N/c1-7-17-38(21-12-10-11-19-37-20-14-13-18-35(8-2)28-29-37)31-40-34(6)25-27-36(9-3)26-24-32(4)30-33(5)39-22-15-16-23-39/h9,25,27-29,33,36,38-39H,3-4,7-8,10-24,26,30-31H2,1-2,5-6H3/b27-25-,35-28?,37-29?,40-34+ |
| InChIKey | UFCFXEAGWJVVDQ-LPANFZRJSA-N |
| XLogP | 12.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.96 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|