C32H59N — CID 123750431
(6Z)-3,7-diethyl-N-methyl-6-(3-methylhexan-2-yl)-5-pentan-2-ylidenepentadeca-6,10-dien-4-imine (PubChem CID 123750431) has the molecular formula C32H59N and a molecular weight of 457.83 g/mol. Its IUPAC name is (6Z)-3,7-diethyl-N-methyl-6-(3-methylhexan-2-yl)-5-pentan-2-ylidenepentadeca-6,10-dien-4-imine.
| Compound Name | (6Z)-3,7-diethyl-N-methyl-6-(3-methylhexan-2-yl)-5-pentan-2-ylidenepentadeca-6,10-dien-4-imine |
|---|---|
| PubChem CID | 123750431 |
| Molecular Formula | C32H59N |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 457.46 |
| IUPAC Name | (6Z)-3,7-diethyl-N-methyl-6-(3-methylhexan-2-yl)-5-pentan-2-ylidenepentadeca-6,10-dien-4-imine |
| SMILES | CCCCC=CCC/C(CC)=C(\C(=C(C)CCC)/C(=N/C)C(CC)CC)C(C)C(C)CCC |
| InChI | InChI=1S/C32H59N/c1-11-17-18-19-20-21-24-29(16-6)31(27(9)25(7)22-12-2)30(26(8)23-13-3)32(33-10)28(14-4)15-5/h19-20,25,27-28H,11-18,21-24H2,1-10H3/b20-19?,30-26?,31-29-,33-32+ |
| InChIKey | YLGARPKIWAMQST-DYKJTIFNSA-N |
| XLogP | 10.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|