C35H59N — CID 123575445
(3E,7E)-9-[cyclobutylidene-(3-methylcyclopentyl)methyl]-N-(3-ethyl-3-methylpentyl)-2,2,3,4,10-pentamethylundeca-3,7,9-trien-5-imine (PubChem CID 123575445) has the molecular formula C35H59N and a molecular weight of 493.86 g/mol. Its IUPAC name is (3E,7E)-9-[cyclobutylidene-(3-methylcyclopentyl)methyl]-N-(3-ethyl-3-methylpentyl)-2,2,3,4,10-pentamethylundeca-3,7,9-trien-5-imine.
| Compound Name | (3E,7E)-9-[cyclobutylidene-(3-methylcyclopentyl)methyl]-N-(3-ethyl-3-methylpentyl)-2,2,3,4,10-pentamethylundeca-3,7,9-trien-5-imine |
|---|---|
| PubChem CID | 123575445 |
| Molecular Formula | C35H59N |
| Molecular Weight | 493.86 g/mol |
| Exact Mass | 493.46 |
| IUPAC Name | (3E,7E)-9-[cyclobutylidene-(3-methylcyclopentyl)methyl]-N-(3-ethyl-3-methylpentyl)-2,2,3,4,10-pentamethylundeca-3,7,9-trien-5-imine |
| SMILES | CCC(C)(CC)CC/N=C(C/C=C/C(=C(C)C)C(=C1CCC1)C1CCC(C)C1)\C(C)=C(/C)C(C)(C)C |
| InChI | InChI=1S/C35H59N/c1-12-35(11,13-2)22-23-36-32(27(6)28(7)34(8,9)10)19-15-18-31(25(3)4)33(29-16-14-17-29)30-21-20-26(5)24-30/h15,18,26,30H,12-14,16-17,19-24H2,1-11H3/b18-15+,28-27+,36-32- |
| InChIKey | FBYDNSGWHQKKIB-VCPJKGGRSA-N |
| XLogP | 11.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.86 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|