C13H19N — CID 90700421
(1Z)-7-methyl-9-azabicyclo[6.5.0]trideca-1,3,8-triene (PubChem CID 90700421) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (1Z)-7-methyl-9-azabicyclo[6.5.0]trideca-1,3,8-triene.
| Compound Name | (1Z)-7-methyl-9-azabicyclo[6.5.0]trideca-1,3,8-triene |
|---|---|
| PubChem CID | 90700421 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (1Z)-7-methyl-9-azabicyclo[6.5.0]trideca-1,3,8-triene |
| SMILES | CC1CCC=C/C=C2/CCCCN=C21 |
| InChI | InChI=1S/C13H19N/c1-11-7-3-2-4-8-12-9-5-6-10-14-13(11)12/h2,4,8,11H,3,5-7,9-10H2,1H3/b4-2?,12-8- |
| InChIKey | CQRCKTLFONUVDT-UYAHFDNISA-N |
| XLogP | 3.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |