C14H16NY- — CID 58631427
CID 58631427 (PubChem CID 58631427) has the molecular formula C14H16NY- and a molecular weight of 287.19 g/mol.
| Compound Name | CID 58631427 |
|---|---|
| PubChem CID | 58631427 |
| Molecular Formula | C14H16NY- |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | — |
| SMILES | C/N=C1\[C@@H]2CC[C@H]1Cc1c[c-]ccc1C2.[Y] |
| InChI | InChI=1S/C14H16N.Y/c1-15-14-12-6-7-13(14)9-11-5-3-2-4-10(11)8-12;/h2,4-5,12-13H,6-9H2,1H3;/q-1;/b15-14+;/t12-,13+;/m1./s1 |
| InChIKey | HXENMSVEPAPVJK-UTWUTWRFSA-N |
| XLogP | 2.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|