C25H39N — CID 142968016
1-[6-(3-cyclopentylpenta-3,4-dienyl)cyclohexa-1,5-dien-1-yl]-N-methyl-2-propylpentan-1-imine (PubChem CID 142968016) has the molecular formula C25H39N and a molecular weight of 353.59 g/mol. Its IUPAC name is 1-[6-(3-cyclopentylpenta-3,4-dienyl)cyclohexa-1,5-dien-1-yl]-N-methyl-2-propylpentan-1-imine.
| Compound Name | 1-[6-(3-cyclopentylpenta-3,4-dienyl)cyclohexa-1,5-dien-1-yl]-N-methyl-2-propylpentan-1-imine |
|---|---|
| PubChem CID | 142968016 |
| Molecular Formula | C25H39N |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | 1-[6-(3-cyclopentylpenta-3,4-dienyl)cyclohexa-1,5-dien-1-yl]-N-methyl-2-propylpentan-1-imine |
| SMILES | C=C=C(CCC1=CCCC=C1/C(=N/C)C(CCC)CCC)C1CCCC1 |
| InChI | InChI=1S/C25H39N/c1-5-12-23(13-6-2)25(26-4)24-17-11-10-16-22(24)19-18-20(7-3)21-14-8-9-15-21/h16-17,21,23H,3,5-6,8-15,18-19H2,1-2,4H3/b26-25+ |
| InChIKey | MOHUMVDEBVUQNM-OCEACIFDSA-N |
| XLogP | 7.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|