C24H38FN — CID 155393975
(5Z)-5-[(E,5E)-5-(1-fluoropropylidene)-7,8-dimethyl-2-methylidenedec-6-enylidene]-N,2,3-trimethylcyclopentan-1-imine (PubChem CID 155393975) has the molecular formula C24H38FN and a molecular weight of 359.57 g/mol. Its IUPAC name is (5Z)-5-[(E,5E)-5-(1-fluoropropylidene)-7,8-dimethyl-2-methylidenedec-6-enylidene]-N,2,3-trimethylcyclopentan-1-imine.
| Compound Name | (5Z)-5-[(E,5E)-5-(1-fluoropropylidene)-7,8-dimethyl-2-methylidenedec-6-enylidene]-N,2,3-trimethylcyclopentan-1-imine |
|---|---|
| PubChem CID | 155393975 |
| Molecular Formula | C24H38FN |
| Molecular Weight | 359.57 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | (5Z)-5-[(E,5E)-5-(1-fluoropropylidene)-7,8-dimethyl-2-methylidenedec-6-enylidene]-N,2,3-trimethylcyclopentan-1-imine |
| SMILES | C=C(/C=C1/CC(C)C(C)/C1=N\C)CCC(/C=C(\C)C(C)CC)=C(\F)CC |
| InChI | InChI=1S/C24H38FN/c1-9-17(4)18(5)14-21(23(25)10-2)12-11-16(3)13-22-15-19(6)20(7)24(22)26-8/h13-14,17,19-20H,3,9-12,15H2,1-2,4-8H3/b18-14+,22-13-,23-21+,26-24+ |
| InChIKey | MKOKQFVBDDTMSU-HJRVEGEXSA-N |
| XLogP | 7.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.57 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|