C28H41N — CID 123520160
(6E)-8-cycloocta-1,7-dien-1-yl-3,9-diethyl-N,7,12-trimethyltrideca-1,2,6,10,12-pentaen-4-imine (PubChem CID 123520160) has the molecular formula C28H41N and a molecular weight of 391.64 g/mol. Its IUPAC name is (6E)-8-cycloocta-1,7-dien-1-yl-3,9-diethyl-N,7,12-trimethyltrideca-1,2,6,10,12-pentaen-4-imine.
| Compound Name | (6E)-8-cycloocta-1,7-dien-1-yl-3,9-diethyl-N,7,12-trimethyltrideca-1,2,6,10,12-pentaen-4-imine |
|---|---|
| PubChem CID | 123520160 |
| Molecular Formula | C28H41N |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.32 |
| IUPAC Name | (6E)-8-cycloocta-1,7-dien-1-yl-3,9-diethyl-N,7,12-trimethyltrideca-1,2,6,10,12-pentaen-4-imine |
| SMILES | C=C=C(CC)/C(C/C=C(\C)C(C1=CCCCCC=C1)C(C=CC(=C)C)CC)=N\C |
| InChI | InChI=1S/C28H41N/c1-8-24(9-2)27(29-7)21-19-23(6)28(25(10-3)20-18-22(4)5)26-16-14-12-11-13-15-17-26/h14,16-20,25,28H,1,4,9-13,15,21H2,2-3,5-7H3/b16-14?,20-18?,23-19+,26-17?,29-27- |
| InChIKey | NUROWKXIBAILRJ-MBJHBWAJSA-N |
| XLogP | 8.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|