C13H19N — CID 91866614
(3Z,5Z,7Z)-2,3-di(propan-2-yl)azocine (PubChem CID 91866614) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (3Z,5Z,7Z)-2,3-di(propan-2-yl)azocine.
| Compound Name | (3Z,5Z,7Z)-2,3-di(propan-2-yl)azocine |
|---|---|
| PubChem CID | 91866614 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (3Z,5Z,7Z)-2,3-di(propan-2-yl)azocine |
| SMILES | CC(C)C1=C/C=C\C=C/N=C\1C(C)C |
| InChI | InChI=1S/C13H19N/c1-10(2)12-8-6-5-7-9-14-13(12)11(3)4/h5-11H,1-4H3/b6-5-,7-5-,8-6-,9-7-,12-8-,13-12+,14-9-,14-13- |
| InChIKey | KGXPFGALPCQZPZ-NOTWQZAISA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |