C13H17N — CID 57297876
2-cyclohexylazocine (PubChem CID 57297876) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-cyclohexylazocine.
| Compound Name | 2-cyclohexylazocine |
|---|---|
| PubChem CID | 57297876 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-cyclohexylazocine |
| SMILES | C1=CC=C/C(C2CCCCC2)=N\C=C1 |
| InChI | InChI=1S/C13H17N/c1-2-7-11-14-13(10-6-1)12-8-4-3-5-9-12/h1-2,6-7,10-12H,3-5,8-9H2/b2-1?,6-1?,7-2?,10-6?,11-7?,13-10?,14-11?,14-13+ |
| InChIKey | FMEWCQZDCWIWLY-FKMHVCAISA-N |
| XLogP | 3.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |