C15H25N — CID 129127582
N-[(1Z)-buta-1,3-dienyl]-4-propyloct-1-en-3-imine (PubChem CID 129127582) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-4-propyloct-1-en-3-imine.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-4-propyloct-1-en-3-imine |
|---|---|
| PubChem CID | 129127582 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-4-propyloct-1-en-3-imine |
| SMILES | C=C/C=C\N=C(/C=C)C(CCC)CCCC |
| InChI | InChI=1S/C15H25N/c1-5-9-12-14(11-7-3)15(8-4)16-13-10-6-2/h6,8,10,13-14H,2,4-5,7,9,11-12H2,1,3H3/b13-10-,16-15+ |
| InChIKey | DRIHDGJHZTYWIG-IKKSVTPCSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|