C27H43N — CID 123309160
N-[(1E)-9-ethenylidene-3-methyl-8-methylidene-2-pent-4-en-2-ylpentadeca-1,14-dienyl]propan-2-imine (PubChem CID 123309160) has the molecular formula C27H43N and a molecular weight of 381.65 g/mol. Its IUPAC name is N-[(1E)-9-ethenylidene-3-methyl-8-methylidene-2-pent-4-en-2-ylpentadeca-1,14-dienyl]propan-2-imine.
| Compound Name | N-[(1E)-9-ethenylidene-3-methyl-8-methylidene-2-pent-4-en-2-ylpentadeca-1,14-dienyl]propan-2-imine |
|---|---|
| PubChem CID | 123309160 |
| Molecular Formula | C27H43N |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.34 |
| IUPAC Name | N-[(1E)-9-ethenylidene-3-methyl-8-methylidene-2-pent-4-en-2-ylpentadeca-1,14-dienyl]propan-2-imine |
| SMILES | C=C=C(CCCCC=C)C(=C)CCCCC(C)/C(=C\N=C(C)C)C(C)CC=C |
| InChI | InChI=1S/C27H43N/c1-9-12-13-14-20-26(11-3)23(6)18-15-16-19-25(8)27(21-28-22(4)5)24(7)17-10-2/h9-10,21,24-25H,1-3,6,12-20H2,4-5,7-8H3/b27-21- |
| InChIKey | LSBBZUPQNGQKOT-MEFGMAGPSA-N |
| XLogP | 8.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|