C23H34FN — CID 134298790
1-fluoro-N-[(1Z)-3-[4-(2-methylhexa-1,5-dien-3-yl)cyclohexyl]buta-1,3-dienyl]hex-5-en-3-imine (PubChem CID 134298790) has the molecular formula C23H34FN and a molecular weight of 343.53 g/mol. Its IUPAC name is 1-fluoro-N-[(1Z)-3-[4-(2-methylhexa-1,5-dien-3-yl)cyclohexyl]buta-1,3-dienyl]hex-5-en-3-imine.
| Compound Name | 1-fluoro-N-[(1Z)-3-[4-(2-methylhexa-1,5-dien-3-yl)cyclohexyl]buta-1,3-dienyl]hex-5-en-3-imine |
|---|---|
| PubChem CID | 134298790 |
| Molecular Formula | C23H34FN |
| Molecular Weight | 343.53 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | 1-fluoro-N-[(1Z)-3-[4-(2-methylhexa-1,5-dien-3-yl)cyclohexyl]buta-1,3-dienyl]hex-5-en-3-imine |
| SMILES | C=CC/C(CCF)=N\C=C/C(=C)C1CCC(C(CC=C)C(=C)C)CC1 |
| InChI | InChI=1S/C23H34FN/c1-6-8-22(14-16-24)25-17-15-19(5)20-10-12-21(13-11-20)23(9-7-2)18(3)4/h6-7,15,17,20-21,23H,1-3,5,8-14,16H2,4H3/b17-15-,25-22+ |
| InChIKey | IZXCOHZZFZXJSX-PTMZNJACSA-N |
| XLogP | 7.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.53 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|