C14H19N — CID 57248852
2-(cyclohexylmethyl)azocine (PubChem CID 57248852) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)azocine.
| Compound Name | 2-(cyclohexylmethyl)azocine |
|---|---|
| PubChem CID | 57248852 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-(cyclohexylmethyl)azocine |
| SMILES | C1=CC=C/C(CC2CCCCC2)=N\C=C1 |
| InChI | InChI=1S/C14H19N/c1-2-7-11-15-14(10-6-1)12-13-8-4-3-5-9-13/h1-2,6-7,10-11,13H,3-5,8-9,12H2/b2-1?,6-1?,7-2?,10-6?,11-7?,14-10?,15-11?,15-14+ |
| InChIKey | HCILVBUBXDMWNV-KUAUWWGCSA-N |
| XLogP | 4.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |