C31H51N — CID 123212759
N-butan-2-yl-10-(3-cyclohepta-2,4-dien-1-ylbut-3-en-2-ylidene)hexadec-3-en-8-imine (PubChem CID 123212759) has the molecular formula C31H51N and a molecular weight of 437.76 g/mol. Its IUPAC name is N-butan-2-yl-10-(3-cyclohepta-2,4-dien-1-ylbut-3-en-2-ylidene)hexadec-3-en-8-imine.
| Compound Name | N-butan-2-yl-10-(3-cyclohepta-2,4-dien-1-ylbut-3-en-2-ylidene)hexadec-3-en-8-imine |
|---|---|
| PubChem CID | 123212759 |
| Molecular Formula | C31H51N |
| Molecular Weight | 437.76 g/mol |
| Exact Mass | 437.40 |
| IUPAC Name | N-butan-2-yl-10-(3-cyclohepta-2,4-dien-1-ylbut-3-en-2-ylidene)hexadec-3-en-8-imine |
| SMILES | C=C(C(C)=C(CCCCCC)C/C(CCCC=CCC)=N/C(C)CC)C1C=CC=CCC1 |
| InChI | InChI=1S/C31H51N/c1-7-10-12-14-20-24-31(32-26(4)9-3)25-30(23-17-13-11-8-2)28(6)27(5)29-21-18-15-16-19-22-29/h10,12,15-16,18,21,26,29H,5,7-9,11,13-14,17,19-20,22-25H2,1-4,6H3/b12-10?,30-28?,32-31+ |
| InChIKey | RPNJRWQSQUOVJV-RAVLXYELSA-N |
| XLogP | 10.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.76 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|