C25H49N — CID 123143028
3,4-dimethyl-N-(3,6,7-trimethyloct-5-en-4-yl)dodecan-2-imine (PubChem CID 123143028) has the molecular formula C25H49N and a molecular weight of 363.67 g/mol. Its IUPAC name is 3,4-dimethyl-N-(3,6,7-trimethyloct-5-en-4-yl)dodecan-2-imine.
| Compound Name | 3,4-dimethyl-N-(3,6,7-trimethyloct-5-en-4-yl)dodecan-2-imine |
|---|---|
| PubChem CID | 123143028 |
| Molecular Formula | C25H49N |
| Molecular Weight | 363.67 g/mol |
| Exact Mass | 363.39 |
| IUPAC Name | 3,4-dimethyl-N-(3,6,7-trimethyloct-5-en-4-yl)dodecan-2-imine |
| SMILES | CCCCCCCCC(C)C(C)/C(C)=N/C(C=C(C)C(C)C)C(C)CC |
| InChI | InChI=1S/C25H49N/c1-10-12-13-14-15-16-17-21(6)23(8)24(9)26-25(20(5)11-2)18-22(7)19(3)4/h18-21,23,25H,10-17H2,1-9H3/b22-18?,26-24+ |
| InChIKey | NJYYFSBRQUUDRZ-DOEVYBLSSA-N |
| XLogP | 8.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.67 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|