C18H31N — CID 123382625
(3Z)-5-ethyl-N,4-di(propan-2-yl)deca-3,5,8-trien-2-imine (PubChem CID 123382625) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is (3Z)-5-ethyl-N,4-di(propan-2-yl)deca-3,5,8-trien-2-imine.
| Compound Name | (3Z)-5-ethyl-N,4-di(propan-2-yl)deca-3,5,8-trien-2-imine |
|---|---|
| PubChem CID | 123382625 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (3Z)-5-ethyl-N,4-di(propan-2-yl)deca-3,5,8-trien-2-imine |
| SMILES | CC=CCC=C(CC)/C(=C\C(C)=N\C(C)C)C(C)C |
| InChI | InChI=1S/C18H31N/c1-8-10-11-12-17(9-2)18(14(3)4)13-16(7)19-15(5)6/h8,10,12-15H,9,11H2,1-7H3/b10-8?,17-12?,18-13-,19-16+ |
| InChIKey | FSMIMPAQPOVVBS-WPNWFCKQSA-N |
| XLogP | 5.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|