C16H22FN — CID 153399315
(2Z,4Z)-1-(4-fluorocyclohexa-1,3-dien-1-yl)-N-propan-2-ylhepta-2,4-dien-1-imine (PubChem CID 153399315) has the molecular formula C16H22FN and a molecular weight of 247.36 g/mol. Its IUPAC name is (2Z,4Z)-1-(4-fluorocyclohexa-1,3-dien-1-yl)-N-propan-2-ylhepta-2,4-dien-1-imine.
| Compound Name | (2Z,4Z)-1-(4-fluorocyclohexa-1,3-dien-1-yl)-N-propan-2-ylhepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 153399315 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (2Z,4Z)-1-(4-fluorocyclohexa-1,3-dien-1-yl)-N-propan-2-ylhepta-2,4-dien-1-imine |
| SMILES | CC/C=C\C=C/C(=N/C(C)C)C1=CC=C(F)CC1 |
| InChI | InChI=1S/C16H22FN/c1-4-5-6-7-8-16(18-13(2)3)14-9-11-15(17)12-10-14/h5-9,11,13H,4,10,12H2,1-3H3/b6-5-,8-7-,18-16- |
| InChIKey | PSXZCBSZFILZAX-DPLZKGJTSA-N |
| XLogP | 4.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|