C13H23N — CID 123563779
7-cyclopentyl-N-methylhept-2-en-4-imine (PubChem CID 123563779) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 7-cyclopentyl-N-methylhept-2-en-4-imine.
| Compound Name | 7-cyclopentyl-N-methylhept-2-en-4-imine |
|---|---|
| PubChem CID | 123563779 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 7-cyclopentyl-N-methylhept-2-en-4-imine |
| SMILES | CC=C/C(CCCC1CCCC1)=N\C |
| InChI | InChI=1S/C13H23N/c1-3-7-13(14-2)11-6-10-12-8-4-5-9-12/h3,7,12H,4-6,8-11H2,1-2H3/b7-3?,14-13+ |
| InChIKey | PXXQAJQAUHABAQ-OUFYTKNASA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|