C30H47N — CID 142232696
(7R)-7-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-3a,5,6,7-tetrahydro-3H-inden-1-yl]-N,2,2-trimethyloctan-3-imine (PubChem CID 142232696) has the molecular formula C30H47N and a molecular weight of 421.71 g/mol. Its IUPAC name is (7R)-7-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-3a,5,6,7-tetrahydro-3H-inden-1-yl]-N,2,2-trimethyloctan-3-imine.
| Compound Name | (7R)-7-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-3a,5,6,7-tetrahydro-3H-inden-1-yl]-N,2,2-trimethyloctan-3-imine |
|---|---|
| PubChem CID | 142232696 |
| Molecular Formula | C30H47N |
| Molecular Weight | 421.71 g/mol |
| Exact Mass | 421.37 |
| IUPAC Name | (7R)-7-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-3a,5,6,7-tetrahydro-3H-inden-1-yl]-N,2,2-trimethyloctan-3-imine |
| SMILES | C=C1CCCC/C1=C/C=C1\CCCC2(C)C([C@H](C)CCC/C(=N/C)C(C)(C)C)=CCC12 |
| InChI | InChI=1S/C30H47N/c1-22-12-8-9-14-24(22)17-18-25-15-11-21-30(6)26(19-20-27(25)30)23(2)13-10-16-28(31-7)29(3,4)5/h17-19,23,27H,1,8-16,20-21H2,2-7H3/b24-17-,25-18+,31-28-/t23-,27?,30?/m1/s1 |
| InChIKey | CZOFOBXWAYUIBC-FAUWNGLOSA-N |
| XLogP | 9.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.71 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|