C30H44FN — CID 143315954
(E)-7-[(4E)-4-[(2Z)-2-(3-fluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-N,2,2-trimethyloct-4-en-3-imine (PubChem CID 143315954) has the molecular formula C30H44FN and a molecular weight of 437.69 g/mol. Its IUPAC name is (E)-7-[(4E)-4-[(2Z)-2-(3-fluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-N,2,2-trimethyloct-4-en-3-imine.
| Compound Name | (E)-7-[(4E)-4-[(2Z)-2-(3-fluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-N,2,2-trimethyloct-4-en-3-imine |
|---|---|
| PubChem CID | 143315954 |
| Molecular Formula | C30H44FN |
| Molecular Weight | 437.69 g/mol |
| Exact Mass | 437.35 |
| IUPAC Name | (E)-7-[(4E)-4-[(2Z)-2-(3-fluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-N,2,2-trimethyloct-4-en-3-imine |
| SMILES | C=C1/C(=C\C=C2/CCCC3(C)C(C(C)C/C=C/C(=N/C)C(C)(C)C)=CCC23)CCCC1F |
| InChI | InChI=1S/C30H44FN/c1-21(11-8-15-28(32-7)29(3,4)5)25-18-19-26-24(13-10-20-30(25,26)6)17-16-23-12-9-14-27(31)22(23)2/h8,15-18,21,26-27H,2,9-14,19-20H2,1,3-7H3/b15-8+,23-16-,24-17+,32-28- |
| InChIKey | YIKLFKSAOSDLCL-WEYRPZQFSA-N |
| XLogP | 8.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.69 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|