C29H42FN — CID 143315952
(E,7R)-7-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-2,2-dimethyloct-4-en-3-imine (PubChem CID 143315952) has the molecular formula C29H42FN and a molecular weight of 423.66 g/mol. Its IUPAC name is (E,7R)-7-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-2,2-dimethyloct-4-en-3-imine.
| Compound Name | (E,7R)-7-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-2,2-dimethyloct-4-en-3-imine |
|---|---|
| PubChem CID | 143315952 |
| Molecular Formula | C29H42FN |
| Molecular Weight | 423.66 g/mol |
| Exact Mass | 423.33 |
| IUPAC Name | (E,7R)-7-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-2,2-dimethyloct-4-en-3-imine |
| SMILES | [H]/N=C(/C=C/C[C@@H](C)C1=CC[C@H]2/C(=C/C=C3/CCC[C@H](F)C3=C)CCC[C@]12C)C(C)(C)C |
| InChI | InChI=1S/C29H42FN/c1-20(10-7-14-27(31)28(3,4)5)24-17-18-25-23(12-9-19-29(24,25)6)16-15-22-11-8-13-26(30)21(22)2/h7,14-17,20,25-26,31H,2,8-13,18-19H2,1,3-6H3/b14-7+,22-15-,23-16+,31-27-/t20-,25+,26+,29-/m1/s1 |
| InChIKey | QJMKWBHUWLYYEL-JDAYVXQCSA-N |
| XLogP | 8.70 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.66 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|