C16H21N — CID 123383260
9-ethyl-9-methyl-3,4,5,6-tetrahydro-1H-fluoren-2-imine (PubChem CID 123383260) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 9-ethyl-9-methyl-3,4,5,6-tetrahydro-1H-fluoren-2-imine.
| Compound Name | 9-ethyl-9-methyl-3,4,5,6-tetrahydro-1H-fluoren-2-imine |
|---|---|
| PubChem CID | 123383260 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 9-ethyl-9-methyl-3,4,5,6-tetrahydro-1H-fluoren-2-imine |
| SMILES | [H]/N=C1\CCC2=C(C1)C(C)(CC)C1=C2CCC=C1 |
| InChI | InChI=1S/C16H21N/c1-3-16(2)14-7-5-4-6-12(14)13-9-8-11(17)10-15(13)16/h5,7,17H,3-4,6,8-10H2,1-2H3/b17-11+ |
| InChIKey | FBOZJZORSFVSCB-GZTJUZNOSA-N |
| XLogP | 4.56 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|