C21H27N — CID 154171771
1-[(9R,10R,13S)-10,13-dimethyl-2,3,4,9,11,12-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanimine (PubChem CID 154171771) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-[(9R,10R,13S)-10,13-dimethyl-2,3,4,9,11,12-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanimine.
| Compound Name | 1-[(9R,10R,13S)-10,13-dimethyl-2,3,4,9,11,12-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanimine |
|---|---|
| PubChem CID | 154171771 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-[(9R,10R,13S)-10,13-dimethyl-2,3,4,9,11,12-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanimine |
| SMILES | [H]/N=C(\C)C1=CC=C2C3=CC=C4CCCC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H27N/c1-14(22)17-9-10-18-16-8-7-15-6-4-5-12-20(15,2)19(16)11-13-21(17,18)3/h7-10,19,22H,4-6,11-13H2,1-3H3/b22-14+/t19-,20-,21+/m0/s1 |
| InChIKey | ZLEDNZGWCMXLFG-TXZTWANPSA-N |
| XLogP | 5.76 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|