C19H29N — CID 90783184
(9R,10R,13S,14S)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-imine (PubChem CID 90783184) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is (9R,10R,13S,14S)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-imine.
| Compound Name | (9R,10R,13S,14S)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-imine |
|---|---|
| PubChem CID | 90783184 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (9R,10R,13S,14S)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-imine |
| SMILES | [H]/N=C1\C=C2CCCC[C@]2(C)[C@@H]2CC[C@]3(C)CCC[C@H]3C12 |
| InChI | InChI=1S/C19H29N/c1-18-9-5-7-14(18)17-15(8-11-18)19(2)10-4-3-6-13(19)12-16(17)20/h12,14-15,17,20H,3-11H2,1-2H3/b20-16+/t14-,15+,17?,18-,19-/m0/s1 |
| InChIKey | KBFHAMISYQJDNG-DXSRIFAXSA-N |
| XLogP | 5.36 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|