C27H46N4 — CID 11820982
(E)-[(3E,10R,13R,14S,17R)-3-hydrazinylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-ylidene]hydrazine (PubChem CID 11820982) has the molecular formula C27H46N4 and a molecular weight of 426.69 g/mol. Its IUPAC name is (E)-[(3E,10R,13R,14S,17R)-3-hydrazinylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-ylidene]hydrazine.
| Compound Name | (E)-[(3E,10R,13R,14S,17R)-3-hydrazinylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-ylidene]hydrazine |
|---|---|
| PubChem CID | 11820982 |
| Molecular Formula | C27H46N4 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.37 |
| IUPAC Name | (E)-[(3E,10R,13R,14S,17R)-3-hydrazinylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,6,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-ylidene]hydrazine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3/C(=N/N)CC4=C/C(=N/N)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C27H46N4/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(30-28)15-19(26)16-24(25)31-29/h15,17-18,21-23,25H,6-14,16,28-29H2,1-5H3/b30-20+,31-24+/t18-,21-,22+,23?,25?,26+,27-/m1/s1 |
| InChIKey | UZTSTTQWKSJVQH-SAYQFMGOSA-N |
| XLogP | 6.27 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|