C18H27N — CID 58587129
3-(cyclohexen-1-yl)-4a,5-dimethyl-2,3,4,5,6,7-hexahydronaphthalen-1-imine (PubChem CID 58587129) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-4a,5-dimethyl-2,3,4,5,6,7-hexahydronaphthalen-1-imine.
| Compound Name | 3-(cyclohexen-1-yl)-4a,5-dimethyl-2,3,4,5,6,7-hexahydronaphthalen-1-imine |
|---|---|
| PubChem CID | 58587129 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 3-(cyclohexen-1-yl)-4a,5-dimethyl-2,3,4,5,6,7-hexahydronaphthalen-1-imine |
| SMILES | [H]/N=C1\CC(C2=CCCCC2)CC2(C)C1=CCCC2C |
| InChI | InChI=1S/C18H27N/c1-13-7-6-10-16-17(19)11-15(12-18(13,16)2)14-8-4-3-5-9-14/h8,10,13,15,19H,3-7,9,11-12H2,1-2H3/b19-17+ |
| InChIKey | NBJJSZBRXSIKKN-HTXNQAPBSA-N |
| XLogP | 5.28 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|