C17H29NO — CID 59842303
(NZ)-N-[(4aR)-4a-methyl-5,6-di(propan-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]hydroxylamine (PubChem CID 59842303) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is (NZ)-N-[(4aR)-4a-methyl-5,6-di(propan-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(4aR)-4a-methyl-5,6-di(propan-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 59842303 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | (NZ)-N-[(4aR)-4a-methyl-5,6-di(propan-2-yl)-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]hydroxylamine |
| SMILES | CC(C)C1CCC2=C/C(=N\O)CC[C@]2(C)C1C(C)C |
| InChI | InChI=1S/C17H29NO/c1-11(2)15-7-6-13-10-14(18-19)8-9-17(13,5)16(15)12(3)4/h10-12,15-16,19H,6-9H2,1-5H3/b18-14-/t15?,16?,17-/m0/s1 |
| InChIKey | ZRHKKBSZUAASLG-RBYZYFMYSA-N |
| XLogP | 4.88 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|