C15H27N — CID 91445250
4-(2,2,3,4-tetramethylpentyl)cyclohex-2-en-1-imine (PubChem CID 91445250) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 4-(2,2,3,4-tetramethylpentyl)cyclohex-2-en-1-imine.
| Compound Name | 4-(2,2,3,4-tetramethylpentyl)cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 91445250 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 4-(2,2,3,4-tetramethylpentyl)cyclohex-2-en-1-imine |
| SMILES | [H]/N=C1/C=CC(CC(C)(C)C(C)C(C)C)CC1 |
| InChI | InChI=1S/C15H27N/c1-11(2)12(3)15(4,5)10-13-6-8-14(16)9-7-13/h6,8,11-13,16H,7,9-10H2,1-5H3/b16-14- |
| InChIKey | BSIRNQDWIKDYBB-PEZBUJJGSA-N |
| XLogP | 4.68 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|