C24H43N — CID 145299275
(Z)-1-cyclohexyl-N,3,5,5-tetramethyloct-2-en-1-imine;(3Z)-2-methylpenta-1,3-diene (PubChem CID 145299275) has the molecular formula C24H43N and a molecular weight of 345.62 g/mol. Its IUPAC name is (Z)-1-cyclohexyl-N,3,5,5-tetramethyloct-2-en-1-imine;(3Z)-2-methylpenta-1,3-diene.
| Compound Name | (Z)-1-cyclohexyl-N,3,5,5-tetramethyloct-2-en-1-imine;(3Z)-2-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 145299275 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | (Z)-1-cyclohexyl-N,3,5,5-tetramethyloct-2-en-1-imine;(3Z)-2-methylpenta-1,3-diene |
| SMILES | C=C(C)/C=C\C.CCCC(C)(C)C/C(C)=C\C(=N/C)C1CCCCC1 |
| InChI | InChI=1S/C18H33N.C6H10/c1-6-12-18(3,4)14-15(2)13-17(19-5)16-10-8-7-9-11-16;1-4-5-6(2)3/h13,16H,6-12,14H2,1-5H3;4-5H,2H2,1,3H3/b15-13-,19-17+;5-4- |
| InChIKey | AYYKMPPRTCALBA-VVRZPCBUSA-N |
| XLogP | 7.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|