C25H37N — CID 145443063
(2Z)-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl)-N-methylpenta-2,4-dien-1-imine (PubChem CID 145443063) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is (2Z)-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl)-N-methylpenta-2,4-dien-1-imine.
| Compound Name | (2Z)-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl)-N-methylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 145443063 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | (2Z)-1-(3,13-dimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-17-yl)-N-methylpenta-2,4-dien-1-imine |
| SMILES | C=C/C=C\C(=N/C)C1=CCC2C3CCC4CC(C)CCC4C3CCC12C |
| InChI | InChI=1S/C25H37N/c1-5-6-7-24(26-4)23-13-12-22-21-11-9-18-16-17(2)8-10-19(18)20(21)14-15-25(22,23)3/h5-7,13,17-22H,1,8-12,14-16H2,2-4H3/b7-6-,26-24+ |
| InChIKey | FYMSCMTYIFIGBU-NSDBJTAGSA-N |
| XLogP | 6.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|