C28H39N — CID 90696195
2-methyl-7-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-3,6-dihydroazocine (PubChem CID 90696195) has the molecular formula C28H39N and a molecular weight of 389.63 g/mol. Its IUPAC name is 2-methyl-7-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-3,6-dihydroazocine.
| Compound Name | 2-methyl-7-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-3,6-dihydroazocine |
|---|---|
| PubChem CID | 90696195 |
| Molecular Formula | C28H39N |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 389.31 |
| IUPAC Name | 2-methyl-7-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-3,6-dihydroazocine |
| SMILES | C/C1=N/C=C(C2=CCC3C4CC=C5CC(C)CCC5(C)C4CCC23C)CC=CC1 |
| InChI | InChI=1S/C28H39N/c1-19-13-15-27(3)22(17-19)9-10-23-25-12-11-24(28(25,4)16-14-26(23)27)21-8-6-5-7-20(2)29-18-21/h5-6,9,11,18-19,23,25-26H,7-8,10,12-17H2,1-4H3/b6-5?,21-18?,29-20- |
| InChIKey | PWJLJOMQONFEIS-KZFJUXHNSA-N |
| XLogP | 7.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|